C13H16N6O2 — CID 102809181
methyl 5-amino-3-(cyclopropylmethylamino)-1-pyrimidin-4-ylpyrazole-4-carboxylate (PubChem CID 102809181) has the molecular formula C13H16N6O2 and a molecular weight of 288.31 g/mol. Its IUPAC name is methyl 5-amino-3-(cyclopropylmethylamino)-1-pyrimidin-4-ylpyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(cyclopropylmethylamino)-1-pyrimidin-4-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102809181 |
| Molecular Formula | C13H16N6O2 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | methyl 5-amino-3-(cyclopropylmethylamino)-1-pyrimidin-4-ylpyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(NCC2CC2)nn(-c2ccncn2)c1N |
| InChI | InChI=1S/C13H16N6O2/c1-21-13(20)10-11(14)19(9-4-5-15-7-17-9)18-12(10)16-6-8-2-3-8/h4-5,7-8H,2-3,6,14H2,1H3,(H,16,18) |
| InChIKey | RKMMAXUSDLMAGH-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |