C9H12N4O2 — CID 66765635
(1-pyrimidin-4-ylpyrrolidin-3-yl)carbamic acid (PubChem CID 66765635) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is (1-pyrimidin-4-ylpyrrolidin-3-yl)carbamic acid.
| Compound Name | (1-pyrimidin-4-ylpyrrolidin-3-yl)carbamic acid |
|---|---|
| PubChem CID | 66765635 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | (1-pyrimidin-4-ylpyrrolidin-3-yl)carbamic acid |
| SMILES | O=C(O)NC1CCN(c2ccncn2)C1 |
| InChI | InChI=1S/C9H12N4O2/c14-9(15)12-7-2-4-13(5-7)8-1-3-10-6-11-8/h1,3,6-7,12H,2,4-5H2,(H,14,15) |
| InChIKey | KYBYUSGEBJXBNA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |