C10H14N4O2 — CID 135335154
[1-(2-amino-4-pyridinyl)pyrrolidin-3-yl]carbamic acid (PubChem CID 135335154) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is [1-(2-amino-4-pyridinyl)pyrrolidin-3-yl]carbamic acid.
| Compound Name | [1-(2-amino-4-pyridinyl)pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 135335154 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | [1-(2-amino-4-pyridinyl)pyrrolidin-3-yl]carbamic acid |
| SMILES | Nc1cc(N2CCC(NC(=O)O)C2)ccn1 |
| InChI | InChI=1S/C10H14N4O2/c11-9-5-8(1-3-12-9)14-4-2-7(6-14)13-10(15)16/h1,3,5,7,13H,2,4,6H2,(H2,11,12)(H,15,16) |
| InChIKey | CKMZJLLFYZPBKG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |