C10H14FN3 — CID 164659406
4-(4-fluoropiperidin-1-yl)pyridin-2-amine (PubChem CID 164659406) has the molecular formula C10H14FN3 and a molecular weight of 195.24 g/mol. Its IUPAC name is 4-(4-fluoropiperidin-1-yl)pyridin-2-amine.
| Compound Name | 4-(4-fluoropiperidin-1-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 164659406 |
| Molecular Formula | C10H14FN3 |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 4-(4-fluoropiperidin-1-yl)pyridin-2-amine |
| SMILES | Nc1cc(N2CCC(F)CC2)ccn1 |
| InChI | InChI=1S/C10H14FN3/c11-8-2-5-14(6-3-8)9-1-4-13-10(12)7-9/h1,4,7-8H,2-3,5-6H2,(H2,12,13) |
| InChIKey | MKUDRKWTVQYMAM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |