C10H14N4O2 — CID 118050075
(1-pyrimidin-4-ylpiperidin-4-yl) carbamate (PubChem CID 118050075) has the molecular formula C10H14N4O2 and a molecular weight of 222.25 g/mol. Its IUPAC name is (1-pyrimidin-4-ylpiperidin-4-yl) carbamate.
| Compound Name | (1-pyrimidin-4-ylpiperidin-4-yl) carbamate |
|---|---|
| PubChem CID | 118050075 |
| Molecular Formula | C10H14N4O2 |
| Molecular Weight | 222.25 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | (1-pyrimidin-4-ylpiperidin-4-yl) carbamate |
| SMILES | NC(=O)OC1CCN(c2ccncn2)CC1 |
| InChI | InChI=1S/C10H14N4O2/c11-10(15)16-8-2-5-14(6-3-8)9-1-4-12-7-13-9/h1,4,7-8H,2-3,5-6H2,(H2,11,15) |
| InChIKey | JLWYBMHNFDOPCJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |