C12H14N4O3 — CID 175570072
(1-furo[2,3-d]pyrimidin-4-ylpiperidin-4-yl) carbamate (PubChem CID 175570072) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is (1-furo[2,3-d]pyrimidin-4-ylpiperidin-4-yl) carbamate.
| Compound Name | (1-furo[2,3-d]pyrimidin-4-ylpiperidin-4-yl) carbamate |
|---|---|
| PubChem CID | 175570072 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (1-furo[2,3-d]pyrimidin-4-ylpiperidin-4-yl) carbamate |
| SMILES | NC(=O)OC1CCN(c2ncnc3occc23)CC1 |
| InChI | InChI=1S/C12H14N4O3/c13-12(17)19-8-1-4-16(5-2-8)10-9-3-6-18-11(9)15-7-14-10/h3,6-8H,1-2,4-5H2,(H2,13,17) |
| InChIKey | QMKDZMIRPNTTCR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |