C12H13BrN4O2S — CID 175315779
[1-(7-bromothieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl] carbamate (PubChem CID 175315779) has the molecular formula C12H13BrN4O2S and a molecular weight of 357.23 g/mol. Its IUPAC name is [1-(7-bromothieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl] carbamate.
| Compound Name | [1-(7-bromothieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175315779 |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.99 |
| IUPAC Name | [1-(7-bromothieno[3,2-d]pyrimidin-4-yl)piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2ncnc3c(Br)csc23)CC1 |
| InChI | InChI=1S/C12H13BrN4O2S/c13-8-5-20-10-9(8)15-6-16-11(10)17-3-1-7(2-4-17)19-12(14)18/h5-7H,1-4H2,(H2,14,18) |
| InChIKey | MUISCOMAIMIUEZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |