C12H15ClN4O3 — CID 175516266
[1-(3-carbamoyl-6-chloro-2-pyridinyl)piperidin-4-yl] carbamate (PubChem CID 175516266) has the molecular formula C12H15ClN4O3 and a molecular weight of 298.73 g/mol. Its IUPAC name is [1-(3-carbamoyl-6-chloro-2-pyridinyl)piperidin-4-yl] carbamate.
| Compound Name | [1-(3-carbamoyl-6-chloro-2-pyridinyl)piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175516266 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | [1-(3-carbamoyl-6-chloro-2-pyridinyl)piperidin-4-yl] carbamate |
| SMILES | NC(=O)OC1CCN(c2nc(Cl)ccc2C(N)=O)CC1 |
| InChI | InChI=1S/C12H15ClN4O3/c13-9-2-1-8(10(14)18)11(16-9)17-5-3-7(4-6-17)20-12(15)19/h1-2,7H,3-6H2,(H2,14,18)(H2,15,19) |
| InChIKey | RGEVYMJEUMRCEV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 111.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|