C15H16F3N7O5 — CID 69378316
[1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-4-yl] carbamate (PubChem CID 69378316) has the molecular formula C15H16F3N7O5 and a molecular weight of 431.33 g/mol. Its IUPAC name is [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-4-yl] carbamate.
| Compound Name | [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 69378316 |
| Molecular Formula | C15H16F3N7O5 |
| Molecular Weight | 431.33 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-4-yl] carbamate |
| SMILES | Cn1nc(C(F)(F)F)cc1Oc1ncnc(N2CCC(OC(N)=O)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H16F3N7O5/c1-23-10(6-9(22-23)15(16,17)18)30-13-11(25(27)28)12(20-7-21-13)24-4-2-8(3-5-24)29-14(19)26/h6-8H,2-5H2,1H3,(H2,19,26) |
| InChIKey | NVGOVHYBGOIYHM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 151.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|