C15H17F3N6O3 — CID 58216375
4-(2,5-dimethylpyrazol-3-yl)oxy-5-nitro-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine (PubChem CID 58216375) has the molecular formula C15H17F3N6O3 and a molecular weight of 386.33 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrazol-3-yl)oxy-5-nitro-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine.
| Compound Name | 4-(2,5-dimethylpyrazol-3-yl)oxy-5-nitro-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 58216375 |
| Molecular Formula | C15H17F3N6O3 |
| Molecular Weight | 386.33 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 4-(2,5-dimethylpyrazol-3-yl)oxy-5-nitro-6-[4-(trifluoromethyl)piperidin-1-yl]pyrimidine |
| SMILES | Cc1cc(Oc2ncnc(N3CCC(C(F)(F)F)CC3)c2[N+](=O)[O-])n(C)n1 |
| InChI | InChI=1S/C15H17F3N6O3/c1-9-7-11(22(2)21-9)27-14-12(24(25)26)13(19-8-20-14)23-5-3-10(4-6-23)15(16,17)18/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | ATHJTXGCROVOPW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|