C19H17F4N7O3 — CID 3556880
4-[4-(2-fluorophenyl)piperazin-1-yl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidine (PubChem CID 3556880) has the molecular formula C19H17F4N7O3 and a molecular weight of 467.38 g/mol. Its IUPAC name is 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidine.
| Compound Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidine |
|---|---|
| PubChem CID | 3556880 |
| Molecular Formula | C19H17F4N7O3 |
| Molecular Weight | 467.38 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-[4-(2-fluorophenyl)piperazin-1-yl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidine |
| SMILES | Cn1nc(C(F)(F)F)cc1Oc1ncnc(N2CCN(c3ccccc3F)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H17F4N7O3/c1-27-15(10-14(26-27)19(21,22)23)33-18-16(30(31)32)17(24-11-25-18)29-8-6-28(7-9-29)13-5-3-2-4-12(13)20/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | ORMRJCOGAJRCMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|