C17H19F3N6O6 — CID 69377537
ethyl [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-3-yl] carbonate (PubChem CID 69377537) has the molecular formula C17H19F3N6O6 and a molecular weight of 460.37 g/mol. Its IUPAC name is ethyl [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-3-yl] carbonate.
| Compound Name | ethyl [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-3-yl] carbonate |
|---|---|
| PubChem CID | 69377537 |
| Molecular Formula | C17H19F3N6O6 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | ethyl [1-[6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]oxy-5-nitropyrimidin-4-yl]piperidin-3-yl] carbonate |
| SMILES | CCOC(=O)OC1CCCN(c2ncnc(Oc3cc(C(F)(F)F)nn3C)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C17H19F3N6O6/c1-3-30-16(27)31-10-5-4-6-25(8-10)14-13(26(28)29)15(22-9-21-14)32-12-7-11(17(18,19)20)23-24(12)2/h7,9-10H,3-6,8H2,1-2H3 |
| InChIKey | IZEBYWIQIHFCEN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|