C21H20BrN5O5 — CID 23494372
ethyl 1-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 23494372) has the molecular formula C21H20BrN5O5 and a molecular weight of 502.33 g/mol. Its IUPAC name is ethyl 1-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 23494372 |
| Molecular Formula | C21H20BrN5O5 |
| Molecular Weight | 502.33 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | ethyl 1-[6-(5-bromoquinolin-8-yl)oxy-5-nitropyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Oc3ccc(Br)c4cccnc34)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C21H20BrN5O5/c1-2-31-21(28)13-5-4-10-26(11-13)19-18(27(29)30)20(25-12-24-19)32-16-8-7-15(22)14-6-3-9-23-17(14)16/h3,6-9,12-13H,2,4-5,10-11H2,1H3 |
| InChIKey | LEXIIEGJNVQBTL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 120.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|