C21H22BrN5O3 — CID 19142301
ethyl 1-[5-amino-6-(5-bromoquinolin-8-yl)oxypyrimidin-4-yl]piperidine-3-carboxylate (PubChem CID 19142301) has the molecular formula C21H22BrN5O3 and a molecular weight of 472.34 g/mol. Its IUPAC name is ethyl 1-[5-amino-6-(5-bromoquinolin-8-yl)oxypyrimidin-4-yl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[5-amino-6-(5-bromoquinolin-8-yl)oxypyrimidin-4-yl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 19142301 |
| Molecular Formula | C21H22BrN5O3 |
| Molecular Weight | 472.34 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | ethyl 1-[5-amino-6-(5-bromoquinolin-8-yl)oxypyrimidin-4-yl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(c2ncnc(Oc3ccc(Br)c4cccnc34)c2N)C1 |
| InChI | InChI=1S/C21H22BrN5O3/c1-2-29-21(28)13-5-4-10-27(11-13)19-17(23)20(26-12-25-19)30-16-8-7-15(22)14-6-3-9-24-18(14)16/h3,6-9,12-13H,2,4-5,10-11,23H2,1H3 |
| InChIKey | OAADOPGNCBJIMP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |