C20H19F6N5O5 — CID 87801667
[1-[6-[3,5-bis(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate (PubChem CID 87801667) has the molecular formula C20H19F6N5O5 and a molecular weight of 523.39 g/mol. Its IUPAC name is [1-[6-[3,5-bis(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate.
| Compound Name | [1-[6-[3,5-bis(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 87801667 |
| Molecular Formula | C20H19F6N5O5 |
| Molecular Weight | 523.39 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [1-[6-[3,5-bis(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]piperidin-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCN(c2ncnc(Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H19F6N5O5/c1-2-35-18(32)36-14-3-5-30(6-4-14)17-15(31(33)34)16(27-10-28-17)29-13-8-11(19(21,22)23)7-12(9-13)20(24,25)26/h7-10,14H,2-6H2,1H3,(H,27,28,29) |
| InChIKey | MGTIQBBUKOQXKK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|