C20H20F3N7O4 — CID 58711902
ethyl 1-[5-nitro-6-[[2-(trifluoromethyl)-3H-benzimidazol-5-yl]amino]pyrimidin-4-yl]piperidine-4-carboxylate (PubChem CID 58711902) has the molecular formula C20H20F3N7O4 and a molecular weight of 479.42 g/mol. Its IUPAC name is ethyl 1-[5-nitro-6-[[2-(trifluoromethyl)-3H-benzimidazol-5-yl]amino]pyrimidin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[5-nitro-6-[[2-(trifluoromethyl)-3H-benzimidazol-5-yl]amino]pyrimidin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58711902 |
| Molecular Formula | C20H20F3N7O4 |
| Molecular Weight | 479.42 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | ethyl 1-[5-nitro-6-[[2-(trifluoromethyl)-3H-benzimidazol-5-yl]amino]pyrimidin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2ncnc(Nc3ccc4nc(C(F)(F)F)[nH]c4c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H20F3N7O4/c1-2-34-18(31)11-5-7-29(8-6-11)17-15(30(32)33)16(24-10-25-17)26-12-3-4-13-14(9-12)28-19(27-13)20(21,22)23/h3-4,9-11H,2,5-8H2,1H3,(H,27,28)(H,24,25,26) |
| InChIKey | DBDKMABQCUTUMV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|