C24H24N4O9S — CID 69376878
ethyl [1-[6-[4-(4-hydroxyphenyl)sulfonylphenoxy]-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate (PubChem CID 69376878) has the molecular formula C24H24N4O9S and a molecular weight of 544.54 g/mol. Its IUPAC name is ethyl [1-[6-[4-(4-hydroxyphenyl)sulfonylphenoxy]-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate.
| Compound Name | ethyl [1-[6-[4-(4-hydroxyphenyl)sulfonylphenoxy]-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate |
|---|---|
| PubChem CID | 69376878 |
| Molecular Formula | C24H24N4O9S |
| Molecular Weight | 544.54 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | ethyl [1-[6-[4-(4-hydroxyphenyl)sulfonylphenoxy]-5-nitropyrimidin-4-yl]piperidin-4-yl] carbonate |
| SMILES | CCOC(=O)OC1CCN(c2ncnc(Oc3ccc(S(=O)(=O)c4ccc(O)cc4)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C24H24N4O9S/c1-2-35-24(30)37-18-11-13-27(14-12-18)22-21(28(31)32)23(26-15-25-22)36-17-5-9-20(10-6-17)38(33,34)19-7-3-16(29)4-8-19/h3-10,15,18,29H,2,11-14H2,1H3 |
| InChIKey | UFXAGFCKKMKHAT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 171.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|