C16H14BrFN4O5 — CID 141107691
1-[6-(4-bromo-2-fluorophenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 141107691) has the molecular formula C16H14BrFN4O5 and a molecular weight of 441.21 g/mol. Its IUPAC name is 1-[6-(4-bromo-2-fluorophenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(4-bromo-2-fluorophenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 141107691 |
| Molecular Formula | C16H14BrFN4O5 |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 440.01 |
| IUPAC Name | 1-[6-(4-bromo-2-fluorophenoxy)-5-nitropyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ncnc(Oc3ccc(Br)cc3F)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H14BrFN4O5/c17-10-1-2-12(11(18)7-10)27-15-13(22(25)26)14(19-8-20-15)21-5-3-9(4-6-21)16(23)24/h1-2,7-9H,3-6H2,(H,23,24) |
| InChIKey | ALECJRAFHTWBJS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|