C17H14N4O7S — CID 142779782
1-[5-nitro-6-[(2-oxo-1,3-benzoxathiol-6-yl)oxy]pyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 142779782) has the molecular formula C17H14N4O7S and a molecular weight of 418.39 g/mol. Its IUPAC name is 1-[5-nitro-6-[(2-oxo-1,3-benzoxathiol-6-yl)oxy]pyrimidin-4-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-nitro-6-[(2-oxo-1,3-benzoxathiol-6-yl)oxy]pyrimidin-4-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 142779782 |
| Molecular Formula | C17H14N4O7S |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-[5-nitro-6-[(2-oxo-1,3-benzoxathiol-6-yl)oxy]pyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ncnc(Oc3ccc4sc(=O)oc4c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C17H14N4O7S/c22-16(23)9-3-5-20(6-4-9)14-13(21(25)26)15(19-8-18-14)27-10-1-2-12-11(7-10)28-17(24)29-12/h1-2,7-9H,3-6H2,(H,22,23) |
| InChIKey | GHHFKZYCXGMVPV-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|