About 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine
4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine (PubChem CID 102826393) has the molecular formula C11H16N6O2S
and a molecular weight of 296.36 g/mol. Its IUPAC name is 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine.
Molecular Properties
| Compound Name | 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine |
| PubChem CID | 102826393 |
| Molecular Formula | C11H16N6O2S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine |
| SMILES | CC(C)Nc1nn(-c2cnccn2)c(N)c1S(C)(=O)=O |
| InChI | InChI=1S/C11H16N6O2S/c1-7(2)15-11-9(20(3,18)19)10(12)17(16-11)8-6-13-4-5-14-8/h4-7H,12H2,1-3H3,(H,15,16) |
| InChIKey | ACJWXGSFBKWUHI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine?
The IUPAC name of 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine (CID 102826393) is 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine.
What is the SMILES notation for 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine?
The canonical SMILES for 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine is CC(C)Nc1nn(-c2cnccn2)c(N)c1S(C)(=O)=O.
What is the InChIKey of 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine?
The InChIKey is ACJWXGSFBKWUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O2S/c1-7(2)15-11-9(20(3,18)19)10(12)17(16-11)8-6-13-4-5-14-8/h4-7H,12H2,1-3H3,(H,15,16).
What are the key properties of 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine?
4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine has a molecular weight of 296.36 g/mol, XLogP of 0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylsulfonyl-3-N-propan-2-yl-1-pyrazin-2-ylpyrazole-3,5-diamine is sourced from PubChem (CID 102826393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).