C14H22N4O3 — CID 102809010
methyl 5-amino-3-(cyclopropylamino)-1-(2-hydroxycyclohexyl)pyrazole-4-carboxylate (PubChem CID 102809010) has the molecular formula C14H22N4O3 and a molecular weight of 294.36 g/mol. Its IUPAC name is methyl 5-amino-3-(cyclopropylamino)-1-(2-hydroxycyclohexyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-amino-3-(cyclopropylamino)-1-(2-hydroxycyclohexyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 102809010 |
| Molecular Formula | C14H22N4O3 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | methyl 5-amino-3-(cyclopropylamino)-1-(2-hydroxycyclohexyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1c(NC2CC2)nn(C2CCCCC2O)c1N |
| InChI | InChI=1S/C14H22N4O3/c1-21-14(20)11-12(15)18(9-4-2-3-5-10(9)19)17-13(11)16-8-6-7-8/h8-10,19H,2-7,15H2,1H3,(H,16,17) |
| InChIKey | CFAWMQDWESPTNQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |