C9H15N3O3S2 — CID 103381681
4-methylsulfonyl-5-(1,4-oxazepan-4-yl)-1,2-thiazol-3-amine (PubChem CID 103381681) has the molecular formula C9H15N3O3S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-methylsulfonyl-5-(1,4-oxazepan-4-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-methylsulfonyl-5-(1,4-oxazepan-4-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103381681 |
| Molecular Formula | C9H15N3O3S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 4-methylsulfonyl-5-(1,4-oxazepan-4-yl)-1,2-thiazol-3-amine |
| SMILES | CS(=O)(=O)c1c(N)nsc1N1CCCOCC1 |
| InChI | InChI=1S/C9H15N3O3S2/c1-17(13,14)7-8(10)11-16-9(7)12-3-2-5-15-6-4-12/h2-6H2,1H3,(H2,10,11) |
| InChIKey | JISOGKDWRQJGOH-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 85.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |