C12H21N3O2S2 — CID 103380926
4-methylsulfonyl-5-(4-propylpiperidin-1-yl)-1,2-thiazol-3-amine (PubChem CID 103380926) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 4-methylsulfonyl-5-(4-propylpiperidin-1-yl)-1,2-thiazol-3-amine.
| Compound Name | 4-methylsulfonyl-5-(4-propylpiperidin-1-yl)-1,2-thiazol-3-amine |
|---|---|
| PubChem CID | 103380926 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-methylsulfonyl-5-(4-propylpiperidin-1-yl)-1,2-thiazol-3-amine |
| SMILES | CCCC1CCN(c2snc(N)c2S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-3-4-9-5-7-15(8-6-9)12-10(19(2,16)17)11(13)14-18-12/h9H,3-8H2,1-2H3,(H2,13,14) |
| InChIKey | URMBITINYFVFBS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |