C16H21N5O2S — CID 126474348
3-(4-methylpiperazin-1-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine (PubChem CID 126474348) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is 3-(4-methylpiperazin-1-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine.
| Compound Name | 3-(4-methylpiperazin-1-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 126474348 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-(4-methylpiperazin-1-yl)-5-(4-methylsulfonylphenyl)pyrazin-2-amine |
| SMILES | CN1CCN(c2nc(-c3ccc(S(C)(=O)=O)cc3)cnc2N)CC1 |
| InChI | InChI=1S/C16H21N5O2S/c1-20-7-9-21(10-8-20)16-15(17)18-11-14(19-16)12-3-5-13(6-4-12)24(2,22)23/h3-6,11H,7-10H2,1-2H3,(H2,17,18) |
| InChIKey | DADMVTDLAAXKLJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |