C23H29N9O2 — CID 176895391
N-(2-acetamidoethyl)-1-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide (PubChem CID 176895391) has the molecular formula C23H29N9O2 and a molecular weight of 463.55 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-1-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-1-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 176895391 |
| Molecular Formula | C23H29N9O2 |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-(2-acetamidoethyl)-1-[3-amino-6-[4-(4-methylpiperazin-1-yl)phenyl]pyrazin-2-yl]pyrazole-4-carboxamide |
| SMILES | CC(=O)NCCNC(=O)c1cnn(-c2nc(-c3ccc(N4CCN(C)CC4)cc3)cnc2N)c1 |
| InChI | InChI=1S/C23H29N9O2/c1-16(33)25-7-8-26-23(34)18-13-28-32(15-18)22-21(24)27-14-20(29-22)17-3-5-19(6-4-17)31-11-9-30(2)10-12-31/h3-6,13-15H,7-12H2,1-2H3,(H2,24,27)(H,25,33)(H,26,34) |
| InChIKey | FFCUMSGVUIEDSK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|