C10H16N6O — CID 102795336
5-amino-1-(2-hydroxyethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile (PubChem CID 102795336) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 5-amino-1-(2-hydroxyethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(2-hydroxyethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795336 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 5-amino-1-(2-hydroxyethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N2CCNCC2)nn(CCO)c1N |
| InChI | InChI=1S/C10H16N6O/c11-7-8-9(12)16(5-6-17)14-10(8)15-3-1-13-2-4-15/h13,17H,1-6,12H2 |
| InChIKey | BYGBJOVMHACFLH-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 103.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |