C13H14BrN7 — CID 102796725
5-amino-1-(5-bromo-2-pyridinyl)-3-piperazin-1-ylpyrazole-4-carbonitrile (PubChem CID 102796725) has the molecular formula C13H14BrN7 and a molecular weight of 348.21 g/mol. Its IUPAC name is 5-amino-1-(5-bromo-2-pyridinyl)-3-piperazin-1-ylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(5-bromo-2-pyridinyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796725 |
| Molecular Formula | C13H14BrN7 |
| Molecular Weight | 348.21 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 5-amino-1-(5-bromo-2-pyridinyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N2CCNCC2)nn(-c2ccc(Br)cn2)c1N |
| InChI | InChI=1S/C13H14BrN7/c14-9-1-2-11(18-8-9)21-12(16)10(7-15)13(19-21)20-5-3-17-4-6-20/h1-2,8,17H,3-6,16H2 |
| InChIKey | VNNCEZPXANWNQY-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |