C12H20N6O2S — CID 102796697
5-amino-1-(2-ethylsulfonylethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile (PubChem CID 102796697) has the molecular formula C12H20N6O2S and a molecular weight of 312.40 g/mol. Its IUPAC name is 5-amino-1-(2-ethylsulfonylethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-(2-ethylsulfonylethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796697 |
| Molecular Formula | C12H20N6O2S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-amino-1-(2-ethylsulfonylethyl)-3-piperazin-1-ylpyrazole-4-carbonitrile |
| SMILES | CCS(=O)(=O)CCn1nc(N2CCNCC2)c(C#N)c1N |
| InChI | InChI=1S/C12H20N6O2S/c1-2-21(19,20)8-7-18-11(14)10(9-13)12(16-18)17-5-3-15-4-6-17/h15H,2-8,14H2,1H3 |
| InChIKey | HRXAOHNZVCRXIG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |