C12H19N5O3S — CID 102796673
5-amino-3-(3-hydroxypiperidin-1-yl)-1-(2-methylsulfonylethyl)pyrazole-4-carbonitrile (PubChem CID 102796673) has the molecular formula C12H19N5O3S and a molecular weight of 313.38 g/mol. Its IUPAC name is 5-amino-3-(3-hydroxypiperidin-1-yl)-1-(2-methylsulfonylethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3-hydroxypiperidin-1-yl)-1-(2-methylsulfonylethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796673 |
| Molecular Formula | C12H19N5O3S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 5-amino-3-(3-hydroxypiperidin-1-yl)-1-(2-methylsulfonylethyl)pyrazole-4-carbonitrile |
| SMILES | CS(=O)(=O)CCn1nc(N2CCCC(O)C2)c(C#N)c1N |
| InChI | InChI=1S/C12H19N5O3S/c1-21(19,20)6-5-17-11(14)10(7-13)12(15-17)16-4-2-3-9(18)8-16/h9,18H,2-6,8,14H2,1H3 |
| InChIKey | VSNBEAVXPKLARO-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 125.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |