C14H15BrN6 — CID 102796328
5-amino-3-(3-aminopyrrolidin-1-yl)-1-(4-bromophenyl)pyrazole-4-carbonitrile (PubChem CID 102796328) has the molecular formula C14H15BrN6 and a molecular weight of 347.22 g/mol. Its IUPAC name is 5-amino-3-(3-aminopyrrolidin-1-yl)-1-(4-bromophenyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3-aminopyrrolidin-1-yl)-1-(4-bromophenyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102796328 |
| Molecular Formula | C14H15BrN6 |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 5-amino-3-(3-aminopyrrolidin-1-yl)-1-(4-bromophenyl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(N2CCC(N)C2)nn(-c2ccc(Br)cc2)c1N |
| InChI | InChI=1S/C14H15BrN6/c15-9-1-3-11(4-2-9)21-13(18)12(7-16)14(19-21)20-6-5-10(17)8-20/h1-4,10H,5-6,8,17-18H2 |
| InChIKey | KODQOVNGGXINNJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |