C16H19N5 — CID 102795272
5-amino-3-(3-methylpiperidin-1-yl)-1-phenylpyrazole-4-carbonitrile (PubChem CID 102795272) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-amino-3-(3-methylpiperidin-1-yl)-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(3-methylpiperidin-1-yl)-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 102795272 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-amino-3-(3-methylpiperidin-1-yl)-1-phenylpyrazole-4-carbonitrile |
| SMILES | CC1CCCN(c2nn(-c3ccccc3)c(N)c2C#N)C1 |
| InChI | InChI=1S/C16H19N5/c1-12-6-5-9-20(11-12)16-14(10-17)15(18)21(19-16)13-7-3-2-4-8-13/h2-4,7-8,12H,5-6,9,11,18H2,1H3 |
| InChIKey | JJBXXAOOKAIHBZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |