C16H18BrN3O — CID 35140111
4-bromo-5-[(3S)-3-methylpiperidin-1-yl]-2-phenylpyridazin-3-one (PubChem CID 35140111) has the molecular formula C16H18BrN3O and a molecular weight of 348.24 g/mol. Its IUPAC name is 4-bromo-5-[(3S)-3-methylpiperidin-1-yl]-2-phenylpyridazin-3-one.
| Compound Name | 4-bromo-5-[(3S)-3-methylpiperidin-1-yl]-2-phenylpyridazin-3-one |
|---|---|
| PubChem CID | 35140111 |
| Molecular Formula | C16H18BrN3O |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 4-bromo-5-[(3S)-3-methylpiperidin-1-yl]-2-phenylpyridazin-3-one |
| SMILES | C[C@H]1CCCN(c2cnn(-c3ccccc3)c(=O)c2Br)C1 |
| InChI | InChI=1S/C16H18BrN3O/c1-12-6-5-9-19(11-12)14-10-18-20(16(21)15(14)17)13-7-3-2-4-8-13/h2-4,7-8,10,12H,5-6,9,11H2,1H3/t12-/m0/s1 |
| InChIKey | XBNYIUWFIWLCCP-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |