C11H12BrN3 — CID 112694717
2-(3-aminopyrrolidin-1-yl)-4-bromobenzonitrile (PubChem CID 112694717) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 2-(3-aminopyrrolidin-1-yl)-4-bromobenzonitrile.
| Compound Name | 2-(3-aminopyrrolidin-1-yl)-4-bromobenzonitrile |
|---|---|
| PubChem CID | 112694717 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 2-(3-aminopyrrolidin-1-yl)-4-bromobenzonitrile |
| SMILES | N#Cc1ccc(Br)cc1N1CCC(N)C1 |
| InChI | InChI=1S/C11H12BrN3/c12-9-2-1-8(6-13)11(5-9)15-4-3-10(14)7-15/h1-2,5,10H,3-4,7,14H2 |
| InChIKey | ZSUPQBJGCNVUSF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |