C16H20BrN3 — CID 114902056
4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzonitrile (PubChem CID 114902056) has the molecular formula C16H20BrN3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzonitrile.
| Compound Name | 4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzonitrile |
|---|---|
| PubChem CID | 114902056 |
| Molecular Formula | C16H20BrN3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzonitrile |
| SMILES | CN1CCCC2CN(c3cc(Br)ccc3C#N)CCC21 |
| InChI | InChI=1S/C16H20BrN3/c1-19-7-2-3-13-11-20(8-6-15(13)19)16-9-14(17)5-4-12(16)10-18/h4-5,9,13,15H,2-3,6-8,11H2,1H3 |
| InChIKey | IZYVCHUGSHLUQP-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |