C16H23BrN2O — CID 81199227
[4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanol (PubChem CID 81199227) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is [4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanol.
| Compound Name | [4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanol |
|---|---|
| PubChem CID | 81199227 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [4-bromo-2-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanol |
| SMILES | CN1CCCC2CN(c3cc(Br)ccc3CO)CCC21 |
| InChI | InChI=1S/C16H23BrN2O/c1-18-7-2-3-12-10-19(8-6-15(12)18)16-9-14(17)5-4-13(16)11-20/h4-5,9,12,15,20H,2-3,6-8,10-11H2,1H3 |
| InChIKey | XPMBNAIYIPKVHC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |