C16H21BrN2OS — CID 107033003
(4-bromo-2-sulfanylphenyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone (PubChem CID 107033003) has the molecular formula C16H21BrN2OS and a molecular weight of 369.33 g/mol. Its IUPAC name is (4-bromo-2-sulfanylphenyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (4-bromo-2-sulfanylphenyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 107033003 |
| Molecular Formula | C16H21BrN2OS |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | (4-bromo-2-sulfanylphenyl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
| SMILES | CN1CCCC2CN(C(=O)c3ccc(Br)cc3S)CCC21 |
| InChI | InChI=1S/C16H21BrN2OS/c1-18-7-2-3-11-10-19(8-6-14(11)18)16(20)13-5-4-12(17)9-15(13)21/h4-5,9,11,14,21H,2-3,6-8,10H2,1H3 |
| InChIKey | HSFMHJYIYXNKCN-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|