C15H21N3O2 — CID 103386618
3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one (PubChem CID 103386618) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one.
| Compound Name | 3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 103386618 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one |
| SMILES | CN1CCCC2CN(C(=O)c3c[nH]ccc3=O)CCC21 |
| InChI | InChI=1S/C15H21N3O2/c1-17-7-2-3-11-10-18(8-5-13(11)17)15(20)12-9-16-6-4-14(12)19/h4,6,9,11,13H,2-3,5,7-8,10H2,1H3,(H,16,19) |
| InChIKey | PLJFUIZBLPHIOW-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |