C14H22N6O — CID 81199262
(6-hydrazinylpyridazin-3-yl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone (PubChem CID 81199262) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is (6-hydrazinylpyridazin-3-yl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (6-hydrazinylpyridazin-3-yl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 81199262 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (6-hydrazinylpyridazin-3-yl)-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)methanone |
| SMILES | CN1CCCC2CN(C(=O)c3ccc(NN)nn3)CCC21 |
| InChI | InChI=1S/C14H22N6O/c1-19-7-2-3-10-9-20(8-6-12(10)19)14(21)11-4-5-13(16-15)18-17-11/h4-5,10,12H,2-3,6-9,15H2,1H3,(H,16,18) |
| InChIKey | QGMJUBXAUIXKTA-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|