C11H17N5O2 — CID 104960538
[(2S,6R)-2,6-dimethylmorpholin-4-yl]-(6-hydrazinylpyridazin-3-yl)methanone (PubChem CID 104960538) has the molecular formula C11H17N5O2 and a molecular weight of 251.29 g/mol. Its IUPAC name is [(2S,6R)-2,6-dimethylmorpholin-4-yl]-(6-hydrazinylpyridazin-3-yl)methanone.
| Compound Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-(6-hydrazinylpyridazin-3-yl)methanone |
|---|---|
| PubChem CID | 104960538 |
| Molecular Formula | C11H17N5O2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | [(2S,6R)-2,6-dimethylmorpholin-4-yl]-(6-hydrazinylpyridazin-3-yl)methanone |
| SMILES | C[C@@H]1CN(C(=O)c2ccc(NN)nn2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H17N5O2/c1-7-5-16(6-8(2)18-7)11(17)9-3-4-10(13-12)15-14-9/h3-4,7-8H,5-6,12H2,1-2H3,(H,13,15)/t7-,8+ |
| InChIKey | CSQHZLGNBKBJKV-OCAPTIKFSA-N |
| XLogP | 0.01 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|