C9H10N6O3 — CID 66062825
4-(6-hydrazinylpyridazine-3-carbonyl)piperazine-2,6-dione (PubChem CID 66062825) has the molecular formula C9H10N6O3 and a molecular weight of 250.22 g/mol. Its IUPAC name is 4-(6-hydrazinylpyridazine-3-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(6-hydrazinylpyridazine-3-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66062825 |
| Molecular Formula | C9H10N6O3 |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 4-(6-hydrazinylpyridazine-3-carbonyl)piperazine-2,6-dione |
| SMILES | NNc1ccc(C(=O)N2CC(=O)NC(=O)C2)nn1 |
| InChI | InChI=1S/C9H10N6O3/c10-12-6-2-1-5(13-14-6)9(18)15-3-7(16)11-8(17)4-15/h1-2H,3-4,10H2,(H,12,14)(H,11,16,17) |
| InChIKey | CYCDLTNIIFDLSP-UHFFFAOYSA-N |
| XLogP | -2.14 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | -2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|