C10H11N5O3 — CID 105072287
4-(3-hydrazinylpyridine-4-carbonyl)piperazine-2,6-dione (PubChem CID 105072287) has the molecular formula C10H11N5O3 and a molecular weight of 249.23 g/mol. Its IUPAC name is 4-(3-hydrazinylpyridine-4-carbonyl)piperazine-2,6-dione.
| Compound Name | 4-(3-hydrazinylpyridine-4-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 105072287 |
| Molecular Formula | C10H11N5O3 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 4-(3-hydrazinylpyridine-4-carbonyl)piperazine-2,6-dione |
| SMILES | NNc1cnccc1C(=O)N1CC(=O)NC(=O)C1 |
| InChI | InChI=1S/C10H11N5O3/c11-14-7-3-12-2-1-6(7)10(18)15-4-8(16)13-9(17)5-15/h1-3,14H,4-5,11H2,(H,13,16,17) |
| InChIKey | ZNBPDDXBSWEXLX-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|