C16H22N2O2 — CID 101244890
phenyl (4aS,8aS)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxylate (PubChem CID 101244890) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is phenyl (4aS,8aS)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxylate.
| Compound Name | phenyl (4aS,8aS)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 101244890 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | phenyl (4aS,8aS)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxylate |
| SMILES | CN1CCC[C@H]2CN(C(=O)Oc3ccccc3)CC[C@@H]21 |
| InChI | InChI=1S/C16H22N2O2/c1-17-10-5-6-13-12-18(11-9-15(13)17)16(19)20-14-7-3-2-4-8-14/h2-4,7-8,13,15H,5-6,9-12H2,1H3/t13-,15-/m0/s1 |
| InChIKey | BCHGJMQWQIPSRX-ZFWWWQNUSA-N |
| XLogP | 2.60 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |