C16H23N3O2 — CID 103785634
2-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one (PubChem CID 103785634) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one.
| Compound Name | 2-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 103785634 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 2-methyl-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)-1H-pyridin-4-one |
| SMILES | Cc1cc(=O)c(C(=O)N2CCC3C(CCCN3C)C2)c[nH]1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-8-15(20)13(9-17-11)16(21)19-7-5-14-12(10-19)4-3-6-18(14)2/h8-9,12,14H,3-7,10H2,1-2H3,(H,17,20) |
| InChIKey | IBSUCQHEMIRMMG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |