C13H16N2O4 — CID 103717650
methyl 1-(6-methyl-4-oxo-1H-pyridine-3-carbonyl)pyrrolidine-3-carboxylate (PubChem CID 103717650) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is methyl 1-(6-methyl-4-oxo-1H-pyridine-3-carbonyl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(6-methyl-4-oxo-1H-pyridine-3-carbonyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 103717650 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | methyl 1-(6-methyl-4-oxo-1H-pyridine-3-carbonyl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)c2c[nH]c(C)cc2=O)C1 |
| InChI | InChI=1S/C13H16N2O4/c1-8-5-11(16)10(6-14-8)12(17)15-4-3-9(7-15)13(18)19-2/h5-6,9H,3-4,7H2,1-2H3,(H,14,16) |
| InChIKey | NBMJABLIFGMWIU-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |