C16H24BrN3 — CID 102814200
[3-bromo-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine (PubChem CID 102814200) has the molecular formula C16H24BrN3 and a molecular weight of 338.29 g/mol. Its IUPAC name is [3-bromo-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine.
| Compound Name | [3-bromo-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 102814200 |
| Molecular Formula | C16H24BrN3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | [3-bromo-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)phenyl]methanamine |
| SMILES | CN1CCCC2CN(c3cc(Br)cc(CN)c3)CCC21 |
| InChI | InChI=1S/C16H24BrN3/c1-19-5-2-3-13-11-20(6-4-16(13)19)15-8-12(10-18)7-14(17)9-15/h7-9,13,16H,2-6,10-11,18H2,1H3 |
| InChIKey | MFJUHXMOQQQMBV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |