C16H21FN2O — CID 106529342
3-fluoro-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzaldehyde (PubChem CID 106529342) has the molecular formula C16H21FN2O and a molecular weight of 276.35 g/mol. Its IUPAC name is 3-fluoro-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzaldehyde.
| Compound Name | 3-fluoro-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzaldehyde |
|---|---|
| PubChem CID | 106529342 |
| Molecular Formula | C16H21FN2O |
| Molecular Weight | 276.35 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-fluoro-5-(1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-6-yl)benzaldehyde |
| SMILES | CN1CCCC2CN(c3cc(F)cc(C=O)c3)CCC21 |
| InChI | InChI=1S/C16H21FN2O/c1-18-5-2-3-13-10-19(6-4-16(13)18)15-8-12(11-20)7-14(17)9-15/h7-9,11,13,16H,2-6,10H2,1H3 |
| InChIKey | OQFOEOUWGJSTTL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|