C17H25BrN2O — CID 61242440
[4-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanol (PubChem CID 61242440) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is [4-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanol.
| Compound Name | [4-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 61242440 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | [4-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanol |
| SMILES | OCc1ccc(Br)cc1N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C17H25BrN2O/c18-15-5-4-14(13-21)17(12-15)20-10-6-16(7-11-20)19-8-2-1-3-9-19/h4-5,12,16,21H,1-3,6-11,13H2 |
| InChIKey | KGBYZFSVIYDMJJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |