C17H26BrN3 — CID 114889518
[5-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanamine (PubChem CID 114889518) has the molecular formula C17H26BrN3 and a molecular weight of 352.32 g/mol. Its IUPAC name is [5-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanamine.
| Compound Name | [5-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 114889518 |
| Molecular Formula | C17H26BrN3 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | [5-bromo-2-(4-piperidin-1-ylpiperidin-1-yl)phenyl]methanamine |
| SMILES | NCc1cc(Br)ccc1N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C17H26BrN3/c18-15-4-5-17(14(12-15)13-19)21-10-6-16(7-11-21)20-8-2-1-3-9-20/h4-5,12,16H,1-3,6-11,13,19H2 |
| InChIKey | CTTAAEOSVYNVEC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |