C15H22ClN3 — CID 63171616
[5-chloro-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)phenyl]methanamine (PubChem CID 63171616) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is [5-chloro-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)phenyl]methanamine.
| Compound Name | [5-chloro-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 63171616 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [5-chloro-2-(3-pyrrolidin-1-ylpyrrolidin-1-yl)phenyl]methanamine |
| SMILES | NCc1cc(Cl)ccc1N1CCC(N2CCCC2)C1 |
| InChI | InChI=1S/C15H22ClN3/c16-13-3-4-15(12(9-13)10-17)19-8-5-14(11-19)18-6-1-2-7-18/h3-4,9,14H,1-2,5-8,10-11,17H2 |
| InChIKey | JSCUJGQPCQCLKM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |