C16H24ClN3 — CID 63172008
[4-chloro-2-(3-piperidin-1-ylpyrrolidin-1-yl)phenyl]methanamine (PubChem CID 63172008) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is [4-chloro-2-(3-piperidin-1-ylpyrrolidin-1-yl)phenyl]methanamine.
| Compound Name | [4-chloro-2-(3-piperidin-1-ylpyrrolidin-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 63172008 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [4-chloro-2-(3-piperidin-1-ylpyrrolidin-1-yl)phenyl]methanamine |
| SMILES | NCc1ccc(Cl)cc1N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C16H24ClN3/c17-14-5-4-13(11-18)16(10-14)20-9-6-15(12-20)19-7-2-1-3-8-19/h4-5,10,15H,1-3,6-9,11-12,18H2 |
| InChIKey | IQPODFFUHIWHIP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |